About 7-[2-(4-ethyl-1,4-diazepan-1-yl)pyrimidin-5-yl]-N-pyrazin-2-ylquinolin-4-amine
7-[2-(4-ethyl-1,4-diazepan-1-yl)pyrimidin-5-yl]-N-pyrazin-2-ylquinolin-4-amine (PubChem CID 155522090) has the molecular formula C24H26N8
and a molecular weight of 426.53 g/mol. Its IUPAC name is 7-[2-(4-ethyl-1,4-diazepan-1-yl)pyrimidin-5-yl]-N-pyrazin-2-ylquinolin-4-amine.
Molecular Properties
| Compound Name | 7-[2-(4-ethyl-1,4-diazepan-1-yl)pyrimidin-5-yl]-N-pyrazin-2-ylquinolin-4-amine |
| PubChem CID | 155522090 |
| Molecular Formula | C24H26N8 |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 7-[2-(4-ethyl-1,4-diazepan-1-yl)pyrimidin-5-yl]-N-pyrazin-2-ylquinolin-4-amine |
| SMILES | CCN1CCCN(c2ncc(-c3ccc4c(Nc5cnccn5)ccnc4c3)cn2)CC1 |
| InChI | InChI=1S/C24H26N8/c1-2-31-10-3-11-32(13-12-31)24-28-15-19(16-29-24)18-4-5-20-21(6-7-26-22(20)14-18)30-23-17-25-8-9-27-23/h4-9,14-17H,2-3,10-13H2,1H3,(H,26,27,30) |
| InChIKey | UTKMGUYBIDQSEZ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 7-[2-(4-ethyl-1,4-diazepan-1-yl)pyrimidin-5-yl]-N-pyrazin-2-ylquinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[2-(4-ethyl-1,4-diazepan-1-yl)pyrimidin-5-yl]-N-pyrazin-2-ylquinolin-4-amine?
The IUPAC name of 7-[2-(4-ethyl-1,4-diazepan-1-yl)pyrimidin-5-yl]-N-pyrazin-2-ylquinolin-4-amine (CID 155522090) is 7-[2-(4-ethyl-1,4-diazepan-1-yl)pyrimidin-5-yl]-N-pyrazin-2-ylquinolin-4-amine.
What is the SMILES notation for 7-[2-(4-ethyl-1,4-diazepan-1-yl)pyrimidin-5-yl]-N-pyrazin-2-ylquinolin-4-amine?
The canonical SMILES for 7-[2-(4-ethyl-1,4-diazepan-1-yl)pyrimidin-5-yl]-N-pyrazin-2-ylquinolin-4-amine is CCN1CCCN(c2ncc(-c3ccc4c(Nc5cnccn5)ccnc4c3)cn2)CC1.
What is the InChIKey of 7-[2-(4-ethyl-1,4-diazepan-1-yl)pyrimidin-5-yl]-N-pyrazin-2-ylquinolin-4-amine?
The InChIKey is UTKMGUYBIDQSEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26N8/c1-2-31-10-3-11-32(13-12-31)24-28-15-19(16-29-24)18-4-5-20-21(6-7-26-22(20)14-18)30-23-17-25-8-9-27-23/h4-9,14-17H,2-3,10-13H2,1H3,(H,26,27,30).
What are the key properties of 7-[2-(4-ethyl-1,4-diazepan-1-yl)pyrimidin-5-yl]-N-pyrazin-2-ylquinolin-4-amine?
7-[2-(4-ethyl-1,4-diazepan-1-yl)pyrimidin-5-yl]-N-pyrazin-2-ylquinolin-4-amine has a molecular weight of 426.53 g/mol, XLogP of 3.76, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[2-(4-ethyl-1,4-diazepan-1-yl)pyrimidin-5-yl]-N-pyrazin-2-ylquinolin-4-amine is sourced from PubChem (CID 155522090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).