C22H15N5O4 — CID 155522299
4-nitro-N-(6-oxo-5,7-dihydrobenzimidazolo[1,2-d][1,4]benzodiazepin-3-yl)benzamide (PubChem CID 155522299) has the molecular formula C22H15N5O4 and a molecular weight of 413.39 g/mol. Its IUPAC name is 4-nitro-N-(6-oxo-5,7-dihydrobenzimidazolo[1,2-d][1,4]benzodiazepin-3-yl)benzamide.
| Compound Name | 4-nitro-N-(6-oxo-5,7-dihydrobenzimidazolo[1,2-d][1,4]benzodiazepin-3-yl)benzamide |
|---|---|
| PubChem CID | 155522299 |
| Molecular Formula | C22H15N5O4 |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 4-nitro-N-(6-oxo-5,7-dihydrobenzimidazolo[1,2-d][1,4]benzodiazepin-3-yl)benzamide |
| SMILES | O=C1Cn2c(nc3ccccc32)-c2ccc(NC(=O)c3ccc([N+](=O)[O-])cc3)cc2N1 |
| InChI | InChI=1S/C22H15N5O4/c28-20-12-26-19-4-2-1-3-17(19)25-21(26)16-10-7-14(11-18(16)24-20)23-22(29)13-5-8-15(9-6-13)27(30)31/h1-11H,12H2,(H,23,29)(H,24,28) |
| InChIKey | WMBNLDJVGATBAB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|