C21H13ClN4 — CID 155522319
8-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methylidene]-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 155522319) has the molecular formula C21H13ClN4 and a molecular weight of 356.82 g/mol. Its IUPAC name is 8-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methylidene]-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 8-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methylidene]-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 155522319 |
| Molecular Formula | C21H13ClN4 |
| Molecular Weight | 356.82 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 8-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methylidene]-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | Clc1ccc(-c2[nH]ncc2C=C2c3cccnc3-c3ncccc32)cc1 |
| InChI | InChI=1S/C21H13ClN4/c22-15-7-5-13(6-8-15)19-14(12-25-26-19)11-18-16-3-1-9-23-20(16)21-17(18)4-2-10-24-21/h1-12H,(H,25,26) |
| InChIKey | OMCAJSUEYMOKLB-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.82 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |