C27H31NO5 — CID 155522384
[(1S,2R,4aS,5R,8aS)-1-formamido-1,4a-dimethyl-6-methylidene-5-[(E)-2-(5-oxo-2H-furan-4-yl)ethenyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl] benzoate (PubChem CID 155522384) has the molecular formula C27H31NO5 and a molecular weight of 449.55 g/mol. Its IUPAC name is [(1S,2R,4aS,5R,8aS)-1-formamido-1,4a-dimethyl-6-methylidene-5-[(E)-2-(5-oxo-2H-furan-4-yl)ethenyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl] benzoate.
| Compound Name | [(1S,2R,4aS,5R,8aS)-1-formamido-1,4a-dimethyl-6-methylidene-5-[(E)-2-(5-oxo-2H-furan-4-yl)ethenyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl] benzoate |
|---|---|
| PubChem CID | 155522384 |
| Molecular Formula | C27H31NO5 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | [(1S,2R,4aS,5R,8aS)-1-formamido-1,4a-dimethyl-6-methylidene-5-[(E)-2-(5-oxo-2H-furan-4-yl)ethenyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl] benzoate |
| SMILES | C=C1CC[C@H]2[C@@](C)(CC[C@@H](OC(=O)c3ccccc3)[C@@]2(C)NC=O)[C@@H]1/C=C/C1=CCOC1=O |
| InChI | InChI=1S/C27H31NO5/c1-18-9-12-22-26(2,21(18)11-10-20-14-16-32-24(20)30)15-13-23(27(22,3)28-17-29)33-25(31)19-7-5-4-6-8-19/h4-8,10-11,14,17,21-23H,1,9,12-13,15-16H2,2-3H3,(H,28,29)/b11-10+/t21-,22+,23-,26+,27+/m1/s1 |
| InChIKey | CINCLPQLCZNZEX-MSVBMEBJSA-N |
| XLogP | 4.14 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|