C20H17F6N5O — CID 155522586
3-[[1-(4,4,4-trifluorobutyl)pyrrolo[3,2-c]pyridin-2-yl]methyl]-1-(2,2,2-trifluoroethyl)imidazo[4,5-c]pyridin-2-one (PubChem CID 155522586) has the molecular formula C20H17F6N5O and a molecular weight of 457.38 g/mol. Its IUPAC name is 3-[[1-(4,4,4-trifluorobutyl)pyrrolo[3,2-c]pyridin-2-yl]methyl]-1-(2,2,2-trifluoroethyl)imidazo[4,5-c]pyridin-2-one.
| Compound Name | 3-[[1-(4,4,4-trifluorobutyl)pyrrolo[3,2-c]pyridin-2-yl]methyl]-1-(2,2,2-trifluoroethyl)imidazo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 155522586 |
| Molecular Formula | C20H17F6N5O |
| Molecular Weight | 457.38 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 3-[[1-(4,4,4-trifluorobutyl)pyrrolo[3,2-c]pyridin-2-yl]methyl]-1-(2,2,2-trifluoroethyl)imidazo[4,5-c]pyridin-2-one |
| SMILES | O=c1n(Cc2cc3cnccc3n2CCCC(F)(F)F)c2cnccc2n1CC(F)(F)F |
| InChI | InChI=1S/C20H17F6N5O/c21-19(22,23)4-1-7-29-14(8-13-9-27-5-2-15(13)29)11-30-17-10-28-6-3-16(17)31(18(30)32)12-20(24,25)26/h2-3,5-6,8-10H,1,4,7,11-12H2 |
| InChIKey | WKDMORGVSPXDJY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 57.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.38 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |