C26H36O8 — CID 155522644
[(1R,2R,4aR,8aS)-2-acetyloxy-5-[(2S)-2-acetyloxy-2-(5-oxo-2H-furan-4-yl)ethyl]-1,4a,6-trimethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl acetate (PubChem CID 155522644) has the molecular formula C26H36O8 and a molecular weight of 476.57 g/mol. Its IUPAC name is [(1R,2R,4aR,8aS)-2-acetyloxy-5-[(2S)-2-acetyloxy-2-(5-oxo-2H-furan-4-yl)ethyl]-1,4a,6-trimethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl acetate.
| Compound Name | [(1R,2R,4aR,8aS)-2-acetyloxy-5-[(2S)-2-acetyloxy-2-(5-oxo-2H-furan-4-yl)ethyl]-1,4a,6-trimethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 155522644 |
| Molecular Formula | C26H36O8 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | [(1R,2R,4aR,8aS)-2-acetyloxy-5-[(2S)-2-acetyloxy-2-(5-oxo-2H-furan-4-yl)ethyl]-1,4a,6-trimethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]1(C)[C@H]2CCC(C)=C(C[C@H](OC(C)=O)C3=CCOC3=O)[C@]2(C)CC[C@H]1OC(C)=O |
| InChI | InChI=1S/C26H36O8/c1-15-7-8-22-25(5,11-9-23(34-18(4)29)26(22,6)14-32-16(2)27)20(15)13-21(33-17(3)28)19-10-12-31-24(19)30/h10,21-23H,7-9,11-14H2,1-6H3/t21-,22-,23+,25-,26-/m0/s1 |
| InChIKey | MMLYLOPUVDMCLU-FOYJLTTRSA-N |
| XLogP | 3.82 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|