About 2-(2-nitro-8-oxo-6-phenylimidazo[1,2-a]pyrazin-7-yl)ethyl acetate
2-(2-nitro-8-oxo-6-phenylimidazo[1,2-a]pyrazin-7-yl)ethyl acetate (PubChem CID 155522659) has the molecular formula C16H14N4O5
and a molecular weight of 342.31 g/mol. Its IUPAC name is 2-(2-nitro-8-oxo-6-phenylimidazo[1,2-a]pyrazin-7-yl)ethyl acetate.
Molecular Properties
| Compound Name | 2-(2-nitro-8-oxo-6-phenylimidazo[1,2-a]pyrazin-7-yl)ethyl acetate |
| PubChem CID | 155522659 |
| Molecular Formula | C16H14N4O5 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 2-(2-nitro-8-oxo-6-phenylimidazo[1,2-a]pyrazin-7-yl)ethyl acetate |
| SMILES | CC(=O)OCCn1c(-c2ccccc2)cn2cc([N+](=O)[O-])nc2c1=O |
| InChI | InChI=1S/C16H14N4O5/c1-11(21)25-8-7-19-13(12-5-3-2-4-6-12)9-18-10-14(20(23)24)17-15(18)16(19)22/h2-6,9-10H,7-8H2,1H3 |
| InChIKey | ANVGHHAQPVUPDT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 108.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-nitro-8-oxo-6-phenylimidazo[1,2-a]pyrazin-7-yl)ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-nitro-8-oxo-6-phenylimidazo[1,2-a]pyrazin-7-yl)ethyl acetate?
The IUPAC name of 2-(2-nitro-8-oxo-6-phenylimidazo[1,2-a]pyrazin-7-yl)ethyl acetate (CID 155522659) is 2-(2-nitro-8-oxo-6-phenylimidazo[1,2-a]pyrazin-7-yl)ethyl acetate.
What is the SMILES notation for 2-(2-nitro-8-oxo-6-phenylimidazo[1,2-a]pyrazin-7-yl)ethyl acetate?
The canonical SMILES for 2-(2-nitro-8-oxo-6-phenylimidazo[1,2-a]pyrazin-7-yl)ethyl acetate is CC(=O)OCCn1c(-c2ccccc2)cn2cc([N+](=O)[O-])nc2c1=O.
What is the InChIKey of 2-(2-nitro-8-oxo-6-phenylimidazo[1,2-a]pyrazin-7-yl)ethyl acetate?
The InChIKey is ANVGHHAQPVUPDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N4O5/c1-11(21)25-8-7-19-13(12-5-3-2-4-6-12)9-18-10-14(20(23)24)17-15(18)16(19)22/h2-6,9-10H,7-8H2,1H3.
What are the key properties of 2-(2-nitro-8-oxo-6-phenylimidazo[1,2-a]pyrazin-7-yl)ethyl acetate?
2-(2-nitro-8-oxo-6-phenylimidazo[1,2-a]pyrazin-7-yl)ethyl acetate has a molecular weight of 342.31 g/mol, XLogP of 1.63, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-nitro-8-oxo-6-phenylimidazo[1,2-a]pyrazin-7-yl)ethyl acetate is sourced from PubChem (CID 155522659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).