C22H22N8O4 — CID 155522680
(2R,3R,4S,5R)-2-[6-amino-2-[(2E)-2-[(4-pyridin-2-ylphenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 155522680) has the molecular formula C22H22N8O4 and a molecular weight of 462.47 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-amino-2-[(2E)-2-[(4-pyridin-2-ylphenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-amino-2-[(2E)-2-[(4-pyridin-2-ylphenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 155522680 |
| Molecular Formula | C22H22N8O4 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-amino-2-[(2E)-2-[(4-pyridin-2-ylphenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Nc1nc(N/N=C/c2ccc(-c3ccccn3)cc2)nc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C22H22N8O4/c23-19-16-20(30(11-25-16)21-18(33)17(32)15(10-31)34-21)28-22(27-19)29-26-9-12-4-6-13(7-5-12)14-3-1-2-8-24-14/h1-9,11,15,17-18,21,31-33H,10H2,(H3,23,27,28,29)/b26-9+/t15-,17-,18-,21-/m1/s1 |
| InChIKey | LOFLMEUTZUZUHN-GSJHMHELSA-N |
| XLogP | 0.53 |
| TPSA | 176.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|