C24H32O6S — CID 155522747
methyl 2-[4-[[(1R,4S,5R,8S,9R,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]sulfanyl]phenyl]acetate (PubChem CID 155522747) has the molecular formula C24H32O6S and a molecular weight of 448.58 g/mol. Its IUPAC name is methyl 2-[4-[[(1R,4S,5R,8S,9R,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]sulfanyl]phenyl]acetate.
| Compound Name | methyl 2-[4-[[(1R,4S,5R,8S,9R,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]sulfanyl]phenyl]acetate |
|---|---|
| PubChem CID | 155522747 |
| Molecular Formula | C24H32O6S |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | methyl 2-[4-[[(1R,4S,5R,8S,9R,10S,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]sulfanyl]phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(S[C@@H]2O[C@@H]3O[C@@]4(C)CC[C@H]5[C@H](C)CC[C@@H]([C@H]2C)[C@@]35OO4)cc1 |
| InChI | InChI=1S/C24H32O6S/c1-14-5-10-19-15(2)21(31-17-8-6-16(7-9-17)13-20(25)26-4)27-22-24(19)18(14)11-12-23(3,28-22)29-30-24/h6-9,14-15,18-19,21-22H,5,10-13H2,1-4H3/t14-,15-,18+,19+,21+,22-,23-,24-/m1/s1 |
| InChIKey | DAZIZFNYPAHFTE-NKBQRIFNSA-N |
| XLogP | 4.70 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|