C19H28O3 — CID 155522748
3-[[(1R,4aR,8aS)-8a-methyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalen-1-yl]methyl]-4-hydroxy-5,6-dimethylpyran-2-one (PubChem CID 155522748) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is 3-[[(1R,4aR,8aS)-8a-methyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalen-1-yl]methyl]-4-hydroxy-5,6-dimethylpyran-2-one.
| Compound Name | 3-[[(1R,4aR,8aS)-8a-methyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalen-1-yl]methyl]-4-hydroxy-5,6-dimethylpyran-2-one |
|---|---|
| PubChem CID | 155522748 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 3-[[(1R,4aR,8aS)-8a-methyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalen-1-yl]methyl]-4-hydroxy-5,6-dimethylpyran-2-one |
| SMILES | Cc1oc(=O)c(C[C@H]2CCC[C@H]3CCCC[C@@]32C)c(O)c1C |
| InChI | InChI=1S/C19H28O3/c1-12-13(2)22-18(21)16(17(12)20)11-15-9-6-8-14-7-4-5-10-19(14,15)3/h14-15,20H,4-11H2,1-3H3/t14-,15-,19+/m1/s1 |
| InChIKey | BVEWGMNJPSOELZ-CLCXKQKWSA-N |
| XLogP | 4.50 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |