C28H31N7O3S2 — CID 155522875
N-[3-[4-(8-amino-3-oxo-2-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-6-yl)anilino]-3-oxopropyl]-5-(dithiolan-3-yl)pentanamide (PubChem CID 155522875) has the molecular formula C28H31N7O3S2 and a molecular weight of 577.74 g/mol. Its IUPAC name is N-[3-[4-(8-amino-3-oxo-2-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-6-yl)anilino]-3-oxopropyl]-5-(dithiolan-3-yl)pentanamide.
| Compound Name | N-[3-[4-(8-amino-3-oxo-2-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-6-yl)anilino]-3-oxopropyl]-5-(dithiolan-3-yl)pentanamide |
|---|---|
| PubChem CID | 155522875 |
| Molecular Formula | C28H31N7O3S2 |
| Molecular Weight | 577.74 g/mol |
| Exact Mass | 577.19 |
| IUPAC Name | N-[3-[4-(8-amino-3-oxo-2-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-6-yl)anilino]-3-oxopropyl]-5-(dithiolan-3-yl)pentanamide |
| SMILES | Nc1nc(-c2ccc(NC(=O)CCNC(=O)CCCCC3CCSS3)cc2)cn2c(=O)n(-c3ccccc3)nc12 |
| InChI | InChI=1S/C28H31N7O3S2/c29-26-27-33-35(21-6-2-1-3-7-21)28(38)34(27)18-23(32-26)19-10-12-20(13-11-19)31-25(37)14-16-30-24(36)9-5-4-8-22-15-17-39-40-22/h1-3,6-7,10-13,18,22H,4-5,8-9,14-17H2,(H2,29,32)(H,30,36)(H,31,37) |
| InChIKey | PSDRVKSUMXGOJT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 136.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.74 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|