C15H17BrF3N7O4S — CID 155523075
N'-(3-bromo-4-fluorophenyl)-4-[2-[5-(2,2-difluoroethyl)-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]ethylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 155523075) has the molecular formula C15H17BrF3N7O4S and a molecular weight of 528.31 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-4-[2-[5-(2,2-difluoroethyl)-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]ethylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-4-[2-[5-(2,2-difluoroethyl)-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]ethylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 155523075 |
| Molecular Formula | C15H17BrF3N7O4S |
| Molecular Weight | 528.31 g/mol |
| Exact Mass | 527.02 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-4-[2-[5-(2,2-difluoroethyl)-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]ethylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | O=S1(=O)N(CCNc2nonc2/C(=N/c2ccc(F)c(Br)c2)NO)CCN1CC(F)F |
| InChI | InChI=1S/C15H17BrF3N7O4S/c16-10-7-9(1-2-11(10)17)21-15(22-27)13-14(24-30-23-13)20-3-4-25-5-6-26(8-12(18)19)31(25,28)29/h1-2,7,12,27H,3-6,8H2,(H,20,24)(H,21,22) |
| InChIKey | PFQSCSKLSDSVKG-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 136.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|