C27H30N6O3S — CID 155523088
(E)-3-[3,5-dimethyl-4-[2-[4-[(4-methylsulfonylpiperazin-1-yl)methyl]anilino]pyrimidin-4-yl]oxyphenyl]prop-2-enenitrile (PubChem CID 155523088) has the molecular formula C27H30N6O3S and a molecular weight of 518.64 g/mol. Its IUPAC name is (E)-3-[3,5-dimethyl-4-[2-[4-[(4-methylsulfonylpiperazin-1-yl)methyl]anilino]pyrimidin-4-yl]oxyphenyl]prop-2-enenitrile.
| Compound Name | (E)-3-[3,5-dimethyl-4-[2-[4-[(4-methylsulfonylpiperazin-1-yl)methyl]anilino]pyrimidin-4-yl]oxyphenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 155523088 |
| Molecular Formula | C27H30N6O3S |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | (E)-3-[3,5-dimethyl-4-[2-[4-[(4-methylsulfonylpiperazin-1-yl)methyl]anilino]pyrimidin-4-yl]oxyphenyl]prop-2-enenitrile |
| SMILES | Cc1cc(/C=C/C#N)cc(C)c1Oc1ccnc(Nc2ccc(CN3CCN(S(C)(=O)=O)CC3)cc2)n1 |
| InChI | InChI=1S/C27H30N6O3S/c1-20-17-23(5-4-11-28)18-21(2)26(20)36-25-10-12-29-27(31-25)30-24-8-6-22(7-9-24)19-32-13-15-33(16-14-32)37(3,34)35/h4-10,12,17-18H,13-16,19H2,1-3H3,(H,29,30,31)/b5-4+ |
| InChIKey | SPQWDVLQSPPBAJ-SNAWJCMRSA-N |
| XLogP | 4.24 |
| TPSA | 111.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|