C33H34N2O7S — CID 155523096
3-[3-[(1R,5S,6R,7S,9S,10S)-3-[4-(3-aminoprop-1-ynyl)phenyl]sulfanyl-5,9-dimethyl-4-oxo-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-en-5-yl]propanoylamino]-2,4-dihydroxybenzoic acid (PubChem CID 155523096) has the molecular formula C33H34N2O7S and a molecular weight of 602.71 g/mol. Its IUPAC name is 3-[3-[(1R,5S,6R,7S,9S,10S)-3-[4-(3-aminoprop-1-ynyl)phenyl]sulfanyl-5,9-dimethyl-4-oxo-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-en-5-yl]propanoylamino]-2,4-dihydroxybenzoic acid.
| Compound Name | 3-[3-[(1R,5S,6R,7S,9S,10S)-3-[4-(3-aminoprop-1-ynyl)phenyl]sulfanyl-5,9-dimethyl-4-oxo-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-en-5-yl]propanoylamino]-2,4-dihydroxybenzoic acid |
|---|---|
| PubChem CID | 155523096 |
| Molecular Formula | C33H34N2O7S |
| Molecular Weight | 602.71 g/mol |
| Exact Mass | 602.21 |
| IUPAC Name | 3-[3-[(1R,5S,6R,7S,9S,10S)-3-[4-(3-aminoprop-1-ynyl)phenyl]sulfanyl-5,9-dimethyl-4-oxo-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-en-5-yl]propanoylamino]-2,4-dihydroxybenzoic acid |
| SMILES | C[C@]12C[C@@]34C=C(Sc5ccc(C#CCN)cc5)C(=O)[C@@](C)(CCC(=O)Nc5c(O)ccc(C(=O)O)c5O)[C@@H]3[C@H](C[C@@H]1C4)O2 |
| InChI | InChI=1S/C33H34N2O7S/c1-31(12-11-25(37)35-26-22(36)10-9-21(27(26)38)30(40)41)28-23-14-19-15-33(28,17-32(19,2)42-23)16-24(29(31)39)43-20-7-5-18(6-8-20)4-3-13-34/h5-10,16,19,23,28,36,38H,11-15,17,34H2,1-2H3,(H,35,37)(H,40,41)/t19-,23+,28+,31+,32+,33-/m1/s1 |
| InChIKey | LWEBMPAKUJEUKX-SDONRBLJSA-N |
| XLogP | 4.66 |
| TPSA | 159.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.71 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|