C33H34IN3O3 — CID 155523098
benzyl N-[(2S)-1-[[(E,2S)-4-(1-methylpyridin-1-ium-2-yl)-1-phenylbut-3-en-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate iodide (PubChem CID 155523098) has the molecular formula C33H34IN3O3 and a molecular weight of 647.56 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[[(E,2S)-4-(1-methylpyridin-1-ium-2-yl)-1-phenylbut-3-en-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate iodide.
| Compound Name | benzyl N-[(2S)-1-[[(E,2S)-4-(1-methylpyridin-1-ium-2-yl)-1-phenylbut-3-en-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate iodide |
|---|---|
| PubChem CID | 155523098 |
| Molecular Formula | C33H34IN3O3 |
| Molecular Weight | 647.56 g/mol |
| Exact Mass | 647.16 |
| IUPAC Name | benzyl N-[(2S)-1-[[(E,2S)-4-(1-methylpyridin-1-ium-2-yl)-1-phenylbut-3-en-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate iodide |
| SMILES | C[n+]1ccccc1/C=C/[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1.[I-] |
| InChI | InChI=1S/C33H33N3O3.HI/c1-36-22-12-11-19-30(36)21-20-29(23-26-13-5-2-6-14-26)34-32(37)31(24-27-15-7-3-8-16-27)35-33(38)39-25-28-17-9-4-10-18-28;/h2-22,29,31H,23-25H2,1H3,(H-,34,35,37,38);1H/b21-20+;/t29-,31+;/m1./s1 |
| InChIKey | ZWHCHZFFFCJQHX-MIHJCZTPSA-N |
| XLogP | 1.79 |
| TPSA | 71.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.56 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|