About 2-[3-[3-(2,6-diamino-5-phenylpyrimidin-4-yl)propoxy]phenoxy]acetic acid;hydrochloride
2-[3-[3-(2,6-diamino-5-phenylpyrimidin-4-yl)propoxy]phenoxy]acetic acid;hydrochloride (PubChem CID 155523154) has the molecular formula C21H23ClN4O4
and a molecular weight of 430.89 g/mol. Its IUPAC name is 2-[3-[3-(2,6-diamino-5-phenylpyrimidin-4-yl)propoxy]phenoxy]acetic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-[3-[3-(2,6-diamino-5-phenylpyrimidin-4-yl)propoxy]phenoxy]acetic acid;hydrochloride |
| PubChem CID | 155523154 |
| Molecular Formula | C21H23ClN4O4 |
| Molecular Weight | 430.89 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 2-[3-[3-(2,6-diamino-5-phenylpyrimidin-4-yl)propoxy]phenoxy]acetic acid;hydrochloride |
| SMILES | Cl.Nc1nc(N)c(-c2ccccc2)c(CCCOc2cccc(OCC(=O)O)c2)n1 |
| InChI | InChI=1S/C21H22N4O4.ClH/c22-20-19(14-6-2-1-3-7-14)17(24-21(23)25-20)10-5-11-28-15-8-4-9-16(12-15)29-13-18(26)27;/h1-4,6-9,12H,5,10-11,13H2,(H,26,27)(H4,22,23,24,25);1H |
| InChIKey | KHKUNYNOUCKVAH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 133.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.89 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[3-(2,6-diamino-5-phenylpyrimidin-4-yl)propoxy]phenoxy]acetic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[3-(2,6-diamino-5-phenylpyrimidin-4-yl)propoxy]phenoxy]acetic acid;hydrochloride?
The IUPAC name of 2-[3-[3-(2,6-diamino-5-phenylpyrimidin-4-yl)propoxy]phenoxy]acetic acid;hydrochloride (CID 155523154) is 2-[3-[3-(2,6-diamino-5-phenylpyrimidin-4-yl)propoxy]phenoxy]acetic acid;hydrochloride.
What is the SMILES notation for 2-[3-[3-(2,6-diamino-5-phenylpyrimidin-4-yl)propoxy]phenoxy]acetic acid;hydrochloride?
The canonical SMILES for 2-[3-[3-(2,6-diamino-5-phenylpyrimidin-4-yl)propoxy]phenoxy]acetic acid;hydrochloride is Cl.Nc1nc(N)c(-c2ccccc2)c(CCCOc2cccc(OCC(=O)O)c2)n1.
What is the InChIKey of 2-[3-[3-(2,6-diamino-5-phenylpyrimidin-4-yl)propoxy]phenoxy]acetic acid;hydrochloride?
The InChIKey is KHKUNYNOUCKVAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N4O4.ClH/c22-20-19(14-6-2-1-3-7-14)17(24-21(23)25-20)10-5-11-28-15-8-4-9-16(12-15)29-13-18(26)27;/h1-4,6-9,12H,5,10-11,13H2,(H,26,27)(H4,22,23,24,25);1H.
What are the key properties of 2-[3-[3-(2,6-diamino-5-phenylpyrimidin-4-yl)propoxy]phenoxy]acetic acid;hydrochloride?
2-[3-[3-(2,6-diamino-5-phenylpyrimidin-4-yl)propoxy]phenoxy]acetic acid;hydrochloride has a molecular weight of 430.89 g/mol, XLogP of 3.20, 9 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[3-(2,6-diamino-5-phenylpyrimidin-4-yl)propoxy]phenoxy]acetic acid;hydrochloride is sourced from PubChem (CID 155523154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).