C22H12N4O4S — CID 155523206
3-[3-(2-oxochromen-3-yl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]chromen-2-one (PubChem CID 155523206) has the molecular formula C22H12N4O4S and a molecular weight of 428.43 g/mol. Its IUPAC name is 3-[3-(2-oxochromen-3-yl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]chromen-2-one.
| Compound Name | 3-[3-(2-oxochromen-3-yl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]chromen-2-one |
|---|---|
| PubChem CID | 155523206 |
| Molecular Formula | C22H12N4O4S |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 3-[3-(2-oxochromen-3-yl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]chromen-2-one |
| SMILES | O=c1oc2ccccc2cc1C1=Nn2c(nnc2-c2cc3ccccc3oc2=O)SC1 |
| InChI | InChI=1S/C22H12N4O4S/c27-20-14(9-12-5-1-3-7-17(12)29-20)16-11-31-22-24-23-19(26(22)25-16)15-10-13-6-2-4-8-18(13)30-21(15)28/h1-10H,11H2 |
| InChIKey | VCVUHVJTTAHPGP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 103.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|