About [4-(1-benzofuran-5-yl)phenyl] cyclohexanesulfonate
[4-(1-benzofuran-5-yl)phenyl] cyclohexanesulfonate (PubChem CID 155523274) has the molecular formula C20H20O4S
and a molecular weight of 356.44 g/mol. Its IUPAC name is [4-(1-benzofuran-5-yl)phenyl] cyclohexanesulfonate.
Molecular Properties
| Compound Name | [4-(1-benzofuran-5-yl)phenyl] cyclohexanesulfonate |
| PubChem CID | 155523274 |
| Molecular Formula | C20H20O4S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | [4-(1-benzofuran-5-yl)phenyl] cyclohexanesulfonate |
| SMILES | O=S(=O)(Oc1ccc(-c2ccc3occc3c2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C20H20O4S/c21-25(22,19-4-2-1-3-5-19)24-18-9-6-15(7-10-18)16-8-11-20-17(14-16)12-13-23-20/h6-14,19H,1-5H2 |
| InChIKey | JXCKMVKUCTUQFN-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-(1-benzofuran-5-yl)phenyl] cyclohexanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1-benzofuran-5-yl)phenyl] cyclohexanesulfonate?
The IUPAC name of [4-(1-benzofuran-5-yl)phenyl] cyclohexanesulfonate (CID 155523274) is [4-(1-benzofuran-5-yl)phenyl] cyclohexanesulfonate.
What is the SMILES notation for [4-(1-benzofuran-5-yl)phenyl] cyclohexanesulfonate?
The canonical SMILES for [4-(1-benzofuran-5-yl)phenyl] cyclohexanesulfonate is O=S(=O)(Oc1ccc(-c2ccc3occc3c2)cc1)C1CCCCC1.
What is the InChIKey of [4-(1-benzofuran-5-yl)phenyl] cyclohexanesulfonate?
The InChIKey is JXCKMVKUCTUQFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20O4S/c21-25(22,19-4-2-1-3-5-19)24-18-9-6-15(7-10-18)16-8-11-20-17(14-16)12-13-23-20/h6-14,19H,1-5H2.
What are the key properties of [4-(1-benzofuran-5-yl)phenyl] cyclohexanesulfonate?
[4-(1-benzofuran-5-yl)phenyl] cyclohexanesulfonate has a molecular weight of 356.44 g/mol, XLogP of 5.14, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1-benzofuran-5-yl)phenyl] cyclohexanesulfonate is sourced from PubChem (CID 155523274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).