C20H21F3N4O4S2 — CID 155523291
N,N-dimethyl-3-oxo-4-[2-[2-(trifluoromethoxy)phenyl]ethyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-triene-11-sulfonamide (PubChem CID 155523291) has the molecular formula C20H21F3N4O4S2 and a molecular weight of 502.54 g/mol. Its IUPAC name is N,N-dimethyl-3-oxo-4-[2-[2-(trifluoromethoxy)phenyl]ethyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-triene-11-sulfonamide.
| Compound Name | N,N-dimethyl-3-oxo-4-[2-[2-(trifluoromethoxy)phenyl]ethyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-triene-11-sulfonamide |
|---|---|
| PubChem CID | 155523291 |
| Molecular Formula | C20H21F3N4O4S2 |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | N,N-dimethyl-3-oxo-4-[2-[2-(trifluoromethoxy)phenyl]ethyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-triene-11-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCc2c(sc3ncn(CCc4ccccc4OC(F)(F)F)c(=O)c23)C1 |
| InChI | InChI=1S/C20H21F3N4O4S2/c1-25(2)33(29,30)27-10-8-14-16(11-27)32-18-17(14)19(28)26(12-24-18)9-7-13-5-3-4-6-15(13)31-20(21,22)23/h3-6,12H,7-11H2,1-2H3 |
| InChIKey | RKGWXYCRRYVGMM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |