C20H23N6O2PS — CID 155523359
4-N-(2-dimethylphosphorylphenyl)-2-N-[1-(2-methoxyethyl)pyrazol-4-yl]thieno[3,2-d]pyrimidine-2,4-diamine (PubChem CID 155523359) has the molecular formula C20H23N6O2PS and a molecular weight of 442.49 g/mol. Its IUPAC name is 4-N-(2-dimethylphosphorylphenyl)-2-N-[1-(2-methoxyethyl)pyrazol-4-yl]thieno[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(2-dimethylphosphorylphenyl)-2-N-[1-(2-methoxyethyl)pyrazol-4-yl]thieno[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 155523359 |
| Molecular Formula | C20H23N6O2PS |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 4-N-(2-dimethylphosphorylphenyl)-2-N-[1-(2-methoxyethyl)pyrazol-4-yl]thieno[3,2-d]pyrimidine-2,4-diamine |
| SMILES | COCCn1cc(Nc2nc(Nc3ccccc3P(C)(C)=O)c3sccc3n2)cn1 |
| InChI | InChI=1S/C20H23N6O2PS/c1-28-10-9-26-13-14(12-21-26)22-20-24-16-8-11-30-18(16)19(25-20)23-15-6-4-5-7-17(15)29(2,3)27/h4-8,11-13H,9-10H2,1-3H3,(H2,22,23,24,25) |
| InChIKey | ALDRWCDJPBGKHM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|