C18H22N2O6S — CID 155523376
(14E)-14-ethylidene-5-methoxy-1,10-diazatetracyclo[11.2.2.03,11.04,9]heptadeca-3(11),4(9),5,7-tetraen-12-one;sulfuric acid (PubChem CID 155523376) has the molecular formula C18H22N2O6S and a molecular weight of 394.45 g/mol. Its IUPAC name is (14E)-14-ethylidene-5-methoxy-1,10-diazatetracyclo[11.2.2.03,11.04,9]heptadeca-3(11),4(9),5,7-tetraen-12-one;sulfuric acid.
| Compound Name | (14E)-14-ethylidene-5-methoxy-1,10-diazatetracyclo[11.2.2.03,11.04,9]heptadeca-3(11),4(9),5,7-tetraen-12-one;sulfuric acid |
|---|---|
| PubChem CID | 155523376 |
| Molecular Formula | C18H22N2O6S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | (14E)-14-ethylidene-5-methoxy-1,10-diazatetracyclo[11.2.2.03,11.04,9]heptadeca-3(11),4(9),5,7-tetraen-12-one;sulfuric acid |
| SMILES | C/C=C1/CN2CCC1C(=O)c1[nH]c3cccc(OC)c3c1C2.O=S(=O)(O)O |
| InChI | InChI=1S/C18H20N2O2.H2O4S/c1-3-11-9-20-8-7-12(11)18(21)17-13(10-20)16-14(19-17)5-4-6-15(16)22-2;1-5(2,3)4/h3-6,12,19H,7-10H2,1-2H3;(H2,1,2,3,4)/b11-3-; |
| InChIKey | FFCCFCFUBGKLTA-PHXMKGPASA-N |
| XLogP | 2.49 |
| TPSA | 119.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|