About 2-[(1,3-dioxo-2-benzofuran-5-carbonyl)amino]-5-methoxybenzoic acid
2-[(1,3-dioxo-2-benzofuran-5-carbonyl)amino]-5-methoxybenzoic acid (PubChem CID 155523403) has the molecular formula C17H11NO7
and a molecular weight of 341.28 g/mol. Its IUPAC name is 2-[(1,3-dioxo-2-benzofuran-5-carbonyl)amino]-5-methoxybenzoic acid.
Molecular Properties
| Compound Name | 2-[(1,3-dioxo-2-benzofuran-5-carbonyl)amino]-5-methoxybenzoic acid |
| PubChem CID | 155523403 |
| Molecular Formula | C17H11NO7 |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 2-[(1,3-dioxo-2-benzofuran-5-carbonyl)amino]-5-methoxybenzoic acid |
| SMILES | COc1ccc(NC(=O)c2ccc3c(c2)C(=O)OC3=O)c(C(=O)O)c1 |
| InChI | InChI=1S/C17H11NO7/c1-24-9-3-5-13(12(7-9)15(20)21)18-14(19)8-2-4-10-11(6-8)17(23)25-16(10)22/h2-7H,1H3,(H,18,19)(H,20,21) |
| InChIKey | ONXNGHVWQQTRFQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1,3-dioxo-2-benzofuran-5-carbonyl)amino]-5-methoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1,3-dioxo-2-benzofuran-5-carbonyl)amino]-5-methoxybenzoic acid?
The IUPAC name of 2-[(1,3-dioxo-2-benzofuran-5-carbonyl)amino]-5-methoxybenzoic acid (CID 155523403) is 2-[(1,3-dioxo-2-benzofuran-5-carbonyl)amino]-5-methoxybenzoic acid.
What is the SMILES notation for 2-[(1,3-dioxo-2-benzofuran-5-carbonyl)amino]-5-methoxybenzoic acid?
The canonical SMILES for 2-[(1,3-dioxo-2-benzofuran-5-carbonyl)amino]-5-methoxybenzoic acid is COc1ccc(NC(=O)c2ccc3c(c2)C(=O)OC3=O)c(C(=O)O)c1.
What is the InChIKey of 2-[(1,3-dioxo-2-benzofuran-5-carbonyl)amino]-5-methoxybenzoic acid?
The InChIKey is ONXNGHVWQQTRFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11NO7/c1-24-9-3-5-13(12(7-9)15(20)21)18-14(19)8-2-4-10-11(6-8)17(23)25-16(10)22/h2-7H,1H3,(H,18,19)(H,20,21).
What are the key properties of 2-[(1,3-dioxo-2-benzofuran-5-carbonyl)amino]-5-methoxybenzoic acid?
2-[(1,3-dioxo-2-benzofuran-5-carbonyl)amino]-5-methoxybenzoic acid has a molecular weight of 341.28 g/mol, XLogP of 1.96, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,3-dioxo-2-benzofuran-5-carbonyl)amino]-5-methoxybenzoic acid is sourced from PubChem (CID 155523403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).