C22H22F3N5OS — CID 155523557
4-[3-[4-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]piperazin-1-yl]propoxy]benzonitrile (PubChem CID 155523557) has the molecular formula C22H22F3N5OS and a molecular weight of 461.51 g/mol. Its IUPAC name is 4-[3-[4-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]piperazin-1-yl]propoxy]benzonitrile.
| Compound Name | 4-[3-[4-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]piperazin-1-yl]propoxy]benzonitrile |
|---|---|
| PubChem CID | 155523557 |
| Molecular Formula | C22H22F3N5OS |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 4-[3-[4-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]piperazin-1-yl]propoxy]benzonitrile |
| SMILES | N#Cc1ccc(OCCCN2CCN(c3ncnc4sc(CC(F)(F)F)cc34)CC2)cc1 |
| InChI | InChI=1S/C22H22F3N5OS/c23-22(24,25)13-18-12-19-20(27-15-28-21(19)32-18)30-9-7-29(8-10-30)6-1-11-31-17-4-2-16(14-26)3-5-17/h2-5,12,15H,1,6-11,13H2 |
| InChIKey | GFXGFUJVRDJZFM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 65.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|