C27H31NO6 — CID 15552356
2-[8-(5,6-dimethoxy-4,7-dioxo-2,3-dihydro-1H-inden-2-yl)octyl]isoindole-1,3-dione (PubChem CID 15552356) has the molecular formula C27H31NO6 and a molecular weight of 465.55 g/mol. Its IUPAC name is 2-[8-(5,6-dimethoxy-4,7-dioxo-2,3-dihydro-1H-inden-2-yl)octyl]isoindole-1,3-dione.
| Compound Name | 2-[8-(5,6-dimethoxy-4,7-dioxo-2,3-dihydro-1H-inden-2-yl)octyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 15552356 |
| Molecular Formula | C27H31NO6 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 2-[8-(5,6-dimethoxy-4,7-dioxo-2,3-dihydro-1H-inden-2-yl)octyl]isoindole-1,3-dione |
| SMILES | COC1=C(OC)C(=O)C2=C(CC(CCCCCCCCN3C(=O)c4ccccc4C3=O)C2)C1=O |
| InChI | InChI=1S/C27H31NO6/c1-33-24-22(29)20-15-17(16-21(20)23(30)25(24)34-2)11-7-5-3-4-6-10-14-28-26(31)18-12-8-9-13-19(18)27(28)32/h8-9,12-13,17H,3-7,10-11,14-16H2,1-2H3 |
| InChIKey | DDTUVOPLEBODAD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|