C40H49N5O2 — CID 155523688
2-[(4-ethoxyphenyl)methyl]-1-(3-methylbutyl)-N-[5-(1,2,3,4-tetrahydroacridin-9-ylamino)pentyl]benzimidazole-5-carboxamide (PubChem CID 155523688) has the molecular formula C40H49N5O2 and a molecular weight of 631.87 g/mol. Its IUPAC name is 2-[(4-ethoxyphenyl)methyl]-1-(3-methylbutyl)-N-[5-(1,2,3,4-tetrahydroacridin-9-ylamino)pentyl]benzimidazole-5-carboxamide.
| Compound Name | 2-[(4-ethoxyphenyl)methyl]-1-(3-methylbutyl)-N-[5-(1,2,3,4-tetrahydroacridin-9-ylamino)pentyl]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 155523688 |
| Molecular Formula | C40H49N5O2 |
| Molecular Weight | 631.87 g/mol |
| Exact Mass | 631.39 |
| IUPAC Name | 2-[(4-ethoxyphenyl)methyl]-1-(3-methylbutyl)-N-[5-(1,2,3,4-tetrahydroacridin-9-ylamino)pentyl]benzimidazole-5-carboxamide |
| SMILES | CCOc1ccc(Cc2nc3cc(C(=O)NCCCCCNc4c5c(nc6ccccc46)CCCC5)ccc3n2CCC(C)C)cc1 |
| InChI | InChI=1S/C40H49N5O2/c1-4-47-31-19-16-29(17-20-31)26-38-44-36-27-30(18-21-37(36)45(38)25-22-28(2)3)40(46)42-24-11-5-10-23-41-39-32-12-6-8-14-34(32)43-35-15-9-7-13-33(35)39/h6,8,12,14,16-21,27-28H,4-5,7,9-11,13,15,22-26H2,1-3H3,(H,41,43)(H,42,46) |
| InChIKey | BQKOWNFTPBQPCP-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.87 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|