C16H10ClN3S — CID 155523898
4-(4-chlorophenyl)-9-thia-3,5,11-triazatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6,11,13-hexaene (PubChem CID 155523898) has the molecular formula C16H10ClN3S and a molecular weight of 311.80 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-9-thia-3,5,11-triazatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6,11,13-hexaene.
| Compound Name | 4-(4-chlorophenyl)-9-thia-3,5,11-triazatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6,11,13-hexaene |
|---|---|
| PubChem CID | 155523898 |
| Molecular Formula | C16H10ClN3S |
| Molecular Weight | 311.80 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 4-(4-chlorophenyl)-9-thia-3,5,11-triazatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6,11,13-hexaene |
| SMILES | Clc1ccc(-c2ncc3c(n2)-c2cccnc2SC3)cc1 |
| InChI | InChI=1S/C16H10ClN3S/c17-12-5-3-10(4-6-12)15-19-8-11-9-21-16-13(14(11)20-15)2-1-7-18-16/h1-8H,9H2 |
| InChIKey | GUSYOISXWNFBSO-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.80 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |