About 2-[3-(3-chloro-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-dimethylazaniumyl]acetate
2-[3-(3-chloro-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-dimethylazaniumyl]acetate (PubChem CID 155523927) has the molecular formula C12H20ClN3O4
and a molecular weight of 305.76 g/mol. Its IUPAC name is 2-[3-(3-chloro-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-dimethylazaniumyl]acetate.
Molecular Properties
| Compound Name | 2-[3-(3-chloro-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-dimethylazaniumyl]acetate |
| PubChem CID | 155523927 |
| Molecular Formula | C12H20ClN3O4 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 2-[3-(3-chloro-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-dimethylazaniumyl]acetate |
| SMILES | CC1(C)C(=O)N(CCC[N+](C)(C)CC(=O)[O-])C(=O)N1Cl |
| InChI | InChI=1S/C12H20ClN3O4/c1-12(2)10(19)14(11(20)15(12)13)6-5-7-16(3,4)8-9(17)18/h5-8H2,1-4H3 |
| InChIKey | NKODUUCYBGTEMF-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(3-chloro-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-dimethylazaniumyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(3-chloro-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-dimethylazaniumyl]acetate?
The IUPAC name of 2-[3-(3-chloro-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-dimethylazaniumyl]acetate (CID 155523927) is 2-[3-(3-chloro-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-dimethylazaniumyl]acetate.
What is the SMILES notation for 2-[3-(3-chloro-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-dimethylazaniumyl]acetate?
The canonical SMILES for 2-[3-(3-chloro-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-dimethylazaniumyl]acetate is CC1(C)C(=O)N(CCC[N+](C)(C)CC(=O)[O-])C(=O)N1Cl.
What is the InChIKey of 2-[3-(3-chloro-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-dimethylazaniumyl]acetate?
The InChIKey is NKODUUCYBGTEMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20ClN3O4/c1-12(2)10(19)14(11(20)15(12)13)6-5-7-16(3,4)8-9(17)18/h5-8H2,1-4H3.
What are the key properties of 2-[3-(3-chloro-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-dimethylazaniumyl]acetate?
2-[3-(3-chloro-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-dimethylazaniumyl]acetate has a molecular weight of 305.76 g/mol, XLogP of -0.60, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(3-chloro-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl-dimethylazaniumyl]acetate is sourced from PubChem (CID 155523927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).