C20H22F2N2O2 — CID 155524049
6-[3-(diethylamino)propoxy]-1,3-difluoro-10H-acridin-9-one (PubChem CID 155524049) has the molecular formula C20H22F2N2O2 and a molecular weight of 360.40 g/mol. Its IUPAC name is 6-[3-(diethylamino)propoxy]-1,3-difluoro-10H-acridin-9-one.
| Compound Name | 6-[3-(diethylamino)propoxy]-1,3-difluoro-10H-acridin-9-one |
|---|---|
| PubChem CID | 155524049 |
| Molecular Formula | C20H22F2N2O2 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 6-[3-(diethylamino)propoxy]-1,3-difluoro-10H-acridin-9-one |
| SMILES | CCN(CC)CCCOc1ccc2c(=O)c3c(F)cc(F)cc3[nH]c2c1 |
| InChI | InChI=1S/C20H22F2N2O2/c1-3-24(4-2)8-5-9-26-14-6-7-15-17(12-14)23-18-11-13(21)10-16(22)19(18)20(15)25/h6-7,10-12H,3-5,8-9H2,1-2H3,(H,23,25) |
| InChIKey | SBYLVYVHCBSERJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|