About 6-(4-hydroxyphenyl)-4H-1,4-benzoxazin-3-one
6-(4-hydroxyphenyl)-4H-1,4-benzoxazin-3-one (PubChem CID 155524143) has the molecular formula C14H11NO3
and a molecular weight of 241.25 g/mol. Its IUPAC name is 6-(4-hydroxyphenyl)-4H-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 6-(4-hydroxyphenyl)-4H-1,4-benzoxazin-3-one |
| PubChem CID | 155524143 |
| Molecular Formula | C14H11NO3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 6-(4-hydroxyphenyl)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(-c3ccc(O)cc3)cc2N1 |
| InChI | InChI=1S/C14H11NO3/c16-11-4-1-9(2-5-11)10-3-6-13-12(7-10)15-14(17)8-18-13/h1-7,16H,8H2,(H,15,17) |
| InChIKey | SXIKJXXVQJVRAR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(4-hydroxyphenyl)-4H-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-hydroxyphenyl)-4H-1,4-benzoxazin-3-one?
The IUPAC name of 6-(4-hydroxyphenyl)-4H-1,4-benzoxazin-3-one (CID 155524143) is 6-(4-hydroxyphenyl)-4H-1,4-benzoxazin-3-one.
What is the SMILES notation for 6-(4-hydroxyphenyl)-4H-1,4-benzoxazin-3-one?
The canonical SMILES for 6-(4-hydroxyphenyl)-4H-1,4-benzoxazin-3-one is O=C1COc2ccc(-c3ccc(O)cc3)cc2N1.
What is the InChIKey of 6-(4-hydroxyphenyl)-4H-1,4-benzoxazin-3-one?
The InChIKey is SXIKJXXVQJVRAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO3/c16-11-4-1-9(2-5-11)10-3-6-13-12(7-10)15-14(17)8-18-13/h1-7,16H,8H2,(H,15,17).
What are the key properties of 6-(4-hydroxyphenyl)-4H-1,4-benzoxazin-3-one?
6-(4-hydroxyphenyl)-4H-1,4-benzoxazin-3-one has a molecular weight of 241.25 g/mol, XLogP of 2.39, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-hydroxyphenyl)-4H-1,4-benzoxazin-3-one is sourced from PubChem (CID 155524143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).