C27H28N6O4S — CID 155524153
N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-4-methoxy-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]phenyl]prop-2-enamide (PubChem CID 155524153) has the molecular formula C27H28N6O4S and a molecular weight of 532.63 g/mol. Its IUPAC name is N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-4-methoxy-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-4-methoxy-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 155524153 |
| Molecular Formula | C27H28N6O4S |
| Molecular Weight | 532.63 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-4-methoxy-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2nccc(-c3cn(C)c4ccccc34)n2)c(OC)cc1N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C27H28N6O4S/c1-4-26(34)29-21-15-22(25(37-3)16-24(21)33-11-13-38(35,36)14-12-33)31-27-28-10-9-20(30-27)19-17-32(2)23-8-6-5-7-18(19)23/h4-10,15-17H,1,11-14H2,2-3H3,(H,29,34)(H,28,30,31) |
| InChIKey | CWVRDKJTAHIYGZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.63 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|