C27H31N3O3S — CID 155524196
7-tert-butyl-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-(4-methoxyphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-one (PubChem CID 155524196) has the molecular formula C27H31N3O3S and a molecular weight of 477.63 g/mol. Its IUPAC name is 7-tert-butyl-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-(4-methoxyphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-one.
| Compound Name | 7-tert-butyl-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-(4-methoxyphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 155524196 |
| Molecular Formula | C27H31N3O3S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 7-tert-butyl-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-(4-methoxyphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-one |
| SMILES | COc1ccc(-c2nc(=O)n(Cc3c(C)noc3C)c3sc4c(c23)CCC(C(C)(C)C)C4)cc1 |
| InChI | InChI=1S/C27H31N3O3S/c1-15-21(16(2)33-29-15)14-30-25-23(20-12-9-18(27(3,4)5)13-22(20)34-25)24(28-26(30)31)17-7-10-19(32-6)11-8-17/h7-8,10-11,18H,9,12-14H2,1-6H3 |
| InChIKey | HEKRQMJLTJPSFB-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 70.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |