C21H21F6N3O5S — CID 155524235
2-(4-ethylsulfonylphenyl)-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-(methylcarbamoylamino)acetamide (PubChem CID 155524235) has the molecular formula C21H21F6N3O5S and a molecular weight of 541.47 g/mol. Its IUPAC name is 2-(4-ethylsulfonylphenyl)-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-(methylcarbamoylamino)acetamide.
| Compound Name | 2-(4-ethylsulfonylphenyl)-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-(methylcarbamoylamino)acetamide |
|---|---|
| PubChem CID | 155524235 |
| Molecular Formula | C21H21F6N3O5S |
| Molecular Weight | 541.47 g/mol |
| Exact Mass | 541.11 |
| IUPAC Name | 2-(4-ethylsulfonylphenyl)-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-(methylcarbamoylamino)acetamide |
| SMILES | CCS(=O)(=O)c1ccc(C(NC(=O)NC)C(=O)Nc2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C21H21F6N3O5S/c1-3-36(34,35)15-10-4-12(5-11-15)16(30-18(32)28-2)17(31)29-14-8-6-13(7-9-14)19(33,20(22,23)24)21(25,26)27/h4-11,16,33H,3H2,1-2H3,(H,29,31)(H2,28,30,32) |
| InChIKey | LSYMIBYPOVQXMU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |