About 2-N,5-N-bis[(4-nitrophenyl)methyl]pyridine-2,5-diamine
2-N,5-N-bis[(4-nitrophenyl)methyl]pyridine-2,5-diamine (PubChem CID 155524237) has the molecular formula C19H17N5O4
and a molecular weight of 379.38 g/mol. Its IUPAC name is 2-N,5-N-bis[(4-nitrophenyl)methyl]pyridine-2,5-diamine.
Molecular Properties
| Compound Name | 2-N,5-N-bis[(4-nitrophenyl)methyl]pyridine-2,5-diamine |
| PubChem CID | 155524237 |
| Molecular Formula | C19H17N5O4 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 2-N,5-N-bis[(4-nitrophenyl)methyl]pyridine-2,5-diamine |
| SMILES | O=[N+]([O-])c1ccc(CNc2ccc(NCc3ccc([N+](=O)[O-])cc3)nc2)cc1 |
| InChI | InChI=1S/C19H17N5O4/c25-23(26)17-6-1-14(2-7-17)11-20-16-5-10-19(22-13-16)21-12-15-3-8-18(9-4-15)24(27)28/h1-10,13,20H,11-12H2,(H,21,22) |
| InChIKey | QVAYJOXYBGIEIS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 123.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-N,5-N-bis[(4-nitrophenyl)methyl]pyridine-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,5-N-bis[(4-nitrophenyl)methyl]pyridine-2,5-diamine?
The IUPAC name of 2-N,5-N-bis[(4-nitrophenyl)methyl]pyridine-2,5-diamine (CID 155524237) is 2-N,5-N-bis[(4-nitrophenyl)methyl]pyridine-2,5-diamine.
What is the SMILES notation for 2-N,5-N-bis[(4-nitrophenyl)methyl]pyridine-2,5-diamine?
The canonical SMILES for 2-N,5-N-bis[(4-nitrophenyl)methyl]pyridine-2,5-diamine is O=[N+]([O-])c1ccc(CNc2ccc(NCc3ccc([N+](=O)[O-])cc3)nc2)cc1.
What is the InChIKey of 2-N,5-N-bis[(4-nitrophenyl)methyl]pyridine-2,5-diamine?
The InChIKey is QVAYJOXYBGIEIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N5O4/c25-23(26)17-6-1-14(2-7-17)11-20-16-5-10-19(22-13-16)21-12-15-3-8-18(9-4-15)24(27)28/h1-10,13,20H,11-12H2,(H,21,22).
What are the key properties of 2-N,5-N-bis[(4-nitrophenyl)methyl]pyridine-2,5-diamine?
2-N,5-N-bis[(4-nitrophenyl)methyl]pyridine-2,5-diamine has a molecular weight of 379.38 g/mol, XLogP of 4.12, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,5-N-bis[(4-nitrophenyl)methyl]pyridine-2,5-diamine is sourced from PubChem (CID 155524237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).