About 1-[(2S,3R)-2-(hydroxymethyl)-3-(4-octylphenyl)pyrrolidin-1-yl]ethanone
1-[(2S,3R)-2-(hydroxymethyl)-3-(4-octylphenyl)pyrrolidin-1-yl]ethanone (PubChem CID 155524241) has the molecular formula C21H33NO2
and a molecular weight of 331.50 g/mol. Its IUPAC name is 1-[(2S,3R)-2-(hydroxymethyl)-3-(4-octylphenyl)pyrrolidin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[(2S,3R)-2-(hydroxymethyl)-3-(4-octylphenyl)pyrrolidin-1-yl]ethanone |
| PubChem CID | 155524241 |
| Molecular Formula | C21H33NO2 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.25 |
| IUPAC Name | 1-[(2S,3R)-2-(hydroxymethyl)-3-(4-octylphenyl)pyrrolidin-1-yl]ethanone |
| SMILES | CCCCCCCCc1ccc([C@H]2CCN(C(C)=O)[C@@H]2CO)cc1 |
| InChI | InChI=1S/C21H33NO2/c1-3-4-5-6-7-8-9-18-10-12-19(13-11-18)20-14-15-22(17(2)24)21(20)16-23/h10-13,20-21,23H,3-9,14-16H2,1-2H3/t20-,21-/m1/s1 |
| InChIKey | ZNSRXOGRGJPXLW-NHCUHLMSSA-N |
| XLogP | 4.29 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2S,3R)-2-(hydroxymethyl)-3-(4-octylphenyl)pyrrolidin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S,3R)-2-(hydroxymethyl)-3-(4-octylphenyl)pyrrolidin-1-yl]ethanone?
The IUPAC name of 1-[(2S,3R)-2-(hydroxymethyl)-3-(4-octylphenyl)pyrrolidin-1-yl]ethanone (CID 155524241) is 1-[(2S,3R)-2-(hydroxymethyl)-3-(4-octylphenyl)pyrrolidin-1-yl]ethanone.
What is the SMILES notation for 1-[(2S,3R)-2-(hydroxymethyl)-3-(4-octylphenyl)pyrrolidin-1-yl]ethanone?
The canonical SMILES for 1-[(2S,3R)-2-(hydroxymethyl)-3-(4-octylphenyl)pyrrolidin-1-yl]ethanone is CCCCCCCCc1ccc([C@H]2CCN(C(C)=O)[C@@H]2CO)cc1.
What is the InChIKey of 1-[(2S,3R)-2-(hydroxymethyl)-3-(4-octylphenyl)pyrrolidin-1-yl]ethanone?
The InChIKey is ZNSRXOGRGJPXLW-NHCUHLMSSA-N. The full InChI is InChI=1S/C21H33NO2/c1-3-4-5-6-7-8-9-18-10-12-19(13-11-18)20-14-15-22(17(2)24)21(20)16-23/h10-13,20-21,23H,3-9,14-16H2,1-2H3/t20-,21-/m1/s1.
What are the key properties of 1-[(2S,3R)-2-(hydroxymethyl)-3-(4-octylphenyl)pyrrolidin-1-yl]ethanone?
1-[(2S,3R)-2-(hydroxymethyl)-3-(4-octylphenyl)pyrrolidin-1-yl]ethanone has a molecular weight of 331.50 g/mol, XLogP of 4.29, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S,3R)-2-(hydroxymethyl)-3-(4-octylphenyl)pyrrolidin-1-yl]ethanone is sourced from PubChem (CID 155524241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).