C21H13Cl3N2OS — CID 155524371
N-[4-methyl-3-(2,4,5-trichlorophenyl)-1,3-thiazol-2-ylidene]naphthalene-1-carboxamide (PubChem CID 155524371) has the molecular formula C21H13Cl3N2OS and a molecular weight of 447.77 g/mol. Its IUPAC name is N-[4-methyl-3-(2,4,5-trichlorophenyl)-1,3-thiazol-2-ylidene]naphthalene-1-carboxamide.
| Compound Name | N-[4-methyl-3-(2,4,5-trichlorophenyl)-1,3-thiazol-2-ylidene]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 155524371 |
| Molecular Formula | C21H13Cl3N2OS |
| Molecular Weight | 447.77 g/mol |
| Exact Mass | 445.98 |
| IUPAC Name | N-[4-methyl-3-(2,4,5-trichlorophenyl)-1,3-thiazol-2-ylidene]naphthalene-1-carboxamide |
| SMILES | Cc1cs/c(=N\C(=O)c2cccc3ccccc23)n1-c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C21H13Cl3N2OS/c1-12-11-28-21(26(12)19-10-17(23)16(22)9-18(19)24)25-20(27)15-8-4-6-13-5-2-3-7-14(13)15/h2-11H,1H3/b25-21- |
| InChIKey | XEFBASXKVZBFIC-DAFNUICNSA-N |
| XLogP | 6.70 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.77 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|