C22H27NO8 — CID 155524380
N-[7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-8-methyl-2-oxochromen-3-yl]cyclopropanecarboxamide (PubChem CID 155524380) has the molecular formula C22H27NO8 and a molecular weight of 433.46 g/mol. Its IUPAC name is N-[7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-8-methyl-2-oxochromen-3-yl]cyclopropanecarboxamide.
| Compound Name | N-[7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-8-methyl-2-oxochromen-3-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 155524380 |
| Molecular Formula | C22H27NO8 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | N-[7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-8-methyl-2-oxochromen-3-yl]cyclopropanecarboxamide |
| SMILES | CO[C@@H]1[C@@H](O)[C@@H](O)[C@H](Oc2ccc3cc(NC(=O)C4CC4)c(=O)oc3c2C)OC1(C)C |
| InChI | InChI=1S/C22H27NO8/c1-10-14(29-21-16(25)15(24)18(28-4)22(2,3)31-21)8-7-12-9-13(20(27)30-17(10)12)23-19(26)11-5-6-11/h7-9,11,15-16,18,21,24-25H,5-6H2,1-4H3,(H,23,26)/t15-,16+,18+,21+/m0/s1 |
| InChIKey | IPYAFTPSGMDOKZ-LTVCHDBBSA-N |
| XLogP | 1.70 |
| TPSA | 127.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|