C25H29N6O3P — CID 155524460
4-N-(2-dimethylphosphorylphenyl)-2-N-(2-methoxy-4-morpholin-4-ylphenyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine (PubChem CID 155524460) has the molecular formula C25H29N6O3P and a molecular weight of 492.52 g/mol. Its IUPAC name is 4-N-(2-dimethylphosphorylphenyl)-2-N-(2-methoxy-4-morpholin-4-ylphenyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(2-dimethylphosphorylphenyl)-2-N-(2-methoxy-4-morpholin-4-ylphenyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 155524460 |
| Molecular Formula | C25H29N6O3P |
| Molecular Weight | 492.52 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 4-N-(2-dimethylphosphorylphenyl)-2-N-(2-methoxy-4-morpholin-4-ylphenyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
| SMILES | COc1cc(N2CCOCC2)ccc1Nc1nc(Nc2ccccc2P(C)(C)=O)c2cc[nH]c2n1 |
| InChI | InChI=1S/C25H29N6O3P/c1-33-21-16-17(31-12-14-34-15-13-31)8-9-19(21)28-25-29-23-18(10-11-26-23)24(30-25)27-20-6-4-5-7-22(20)35(2,3)32/h4-11,16H,12-15H2,1-3H3,(H3,26,27,28,29,30) |
| InChIKey | MADATSXKDQVKSH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 104.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|