C17H10F8N2O3 — CID 155524502
2,2,3,3,3-pentafluoro-N-[2-(hydroxyamino)-2-oxo-1-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]propanamide (PubChem CID 155524502) has the molecular formula C17H10F8N2O3 and a molecular weight of 442.26 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N-[2-(hydroxyamino)-2-oxo-1-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]propanamide.
| Compound Name | 2,2,3,3,3-pentafluoro-N-[2-(hydroxyamino)-2-oxo-1-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]propanamide |
|---|---|
| PubChem CID | 155524502 |
| Molecular Formula | C17H10F8N2O3 |
| Molecular Weight | 442.26 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N-[2-(hydroxyamino)-2-oxo-1-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]propanamide |
| SMILES | O=C(NO)C(NC(=O)C(F)(F)C(F)(F)F)c1ccc(-c2cc(F)c(F)c(F)c2)cc1 |
| InChI | InChI=1S/C17H10F8N2O3/c18-10-5-9(6-11(19)12(10)20)7-1-3-8(4-2-7)13(14(28)27-30)26-15(29)16(21,22)17(23,24)25/h1-6,13,30H,(H,26,29)(H,27,28) |
| InChIKey | JYMLTMFCQQPKRL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.26 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|