C20H23BrFN6O4P — CID 155524514
4-[2-[[benzyl(ethoxy)phosphoryl]amino]ethylamino]-N'-(3-bromo-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 155524514) has the molecular formula C20H23BrFN6O4P and a molecular weight of 541.32 g/mol. Its IUPAC name is 4-[2-[[benzyl(ethoxy)phosphoryl]amino]ethylamino]-N'-(3-bromo-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-[2-[[benzyl(ethoxy)phosphoryl]amino]ethylamino]-N'-(3-bromo-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 155524514 |
| Molecular Formula | C20H23BrFN6O4P |
| Molecular Weight | 541.32 g/mol |
| Exact Mass | 540.07 |
| IUPAC Name | 4-[2-[[benzyl(ethoxy)phosphoryl]amino]ethylamino]-N'-(3-bromo-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CCOP(=O)(Cc1ccccc1)NCCNc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO |
| InChI | InChI=1S/C20H23BrFN6O4P/c1-2-31-33(30,13-14-6-4-3-5-7-14)24-11-10-23-19-18(27-32-28-19)20(26-29)25-15-8-9-17(22)16(21)12-15/h3-9,12,29H,2,10-11,13H2,1H3,(H,23,28)(H,24,30)(H,25,26) |
| InChIKey | DTXLIPZCPNFSSX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 133.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.32 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|