C40H49N5O2 — CID 155524523
2-[(4-ethoxyphenyl)methyl]-N,N-diethyl-1-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]benzimidazole-5-carboxamide (PubChem CID 155524523) has the molecular formula C40H49N5O2 and a molecular weight of 631.87 g/mol. Its IUPAC name is 2-[(4-ethoxyphenyl)methyl]-N,N-diethyl-1-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]benzimidazole-5-carboxamide.
| Compound Name | 2-[(4-ethoxyphenyl)methyl]-N,N-diethyl-1-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 155524523 |
| Molecular Formula | C40H49N5O2 |
| Molecular Weight | 631.87 g/mol |
| Exact Mass | 631.39 |
| IUPAC Name | 2-[(4-ethoxyphenyl)methyl]-N,N-diethyl-1-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]benzimidazole-5-carboxamide |
| SMILES | CCOc1ccc(Cc2nc3cc(C(=O)N(CC)CC)ccc3n2CCCCCCNc2c3c(nc4ccccc24)CCCC3)cc1 |
| InChI | InChI=1S/C40H49N5O2/c1-4-44(5-2)40(46)30-21-24-37-36(28-30)43-38(27-29-19-22-31(23-20-29)47-6-3)45(37)26-14-8-7-13-25-41-39-32-15-9-11-17-34(32)42-35-18-12-10-16-33(35)39/h9,11,15,17,19-24,28H,4-8,10,12-14,16,18,25-27H2,1-3H3,(H,41,42) |
| InChIKey | UTGZBXOXPAIMOK-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.87 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|