C20H23ClN2 — CID 155524557
2-benzyl-9-methyl-3,4,5,6-tetrahydro-1H-azepino[4,3-b]indole;hydrochloride (PubChem CID 155524557) has the molecular formula C20H23ClN2 and a molecular weight of 326.87 g/mol. Its IUPAC name is 2-benzyl-9-methyl-3,4,5,6-tetrahydro-1H-azepino[4,3-b]indole;hydrochloride.
| Compound Name | 2-benzyl-9-methyl-3,4,5,6-tetrahydro-1H-azepino[4,3-b]indole;hydrochloride |
|---|---|
| PubChem CID | 155524557 |
| Molecular Formula | C20H23ClN2 |
| Molecular Weight | 326.87 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 2-benzyl-9-methyl-3,4,5,6-tetrahydro-1H-azepino[4,3-b]indole;hydrochloride |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CN(Cc1ccccc1)CCC3.Cl |
| InChI | InChI=1S/C20H22N2.ClH/c1-15-9-10-20-17(12-15)18-14-22(11-5-8-19(18)21-20)13-16-6-3-2-4-7-16;/h2-4,6-7,9-10,12,21H,5,8,11,13-14H2,1H3;1H |
| InChIKey | XTBSNYUIDSMONC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.87 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|