C19H11Br2F5N2 — CID 155524574
5-bromo-3-[1-(5-bromo-1H-indol-3-yl)-2,2,3,3,3-pentafluoropropyl]-1H-indole (PubChem CID 155524574) has the molecular formula C19H11Br2F5N2 and a molecular weight of 522.11 g/mol. Its IUPAC name is 5-bromo-3-[1-(5-bromo-1H-indol-3-yl)-2,2,3,3,3-pentafluoropropyl]-1H-indole.
| Compound Name | 5-bromo-3-[1-(5-bromo-1H-indol-3-yl)-2,2,3,3,3-pentafluoropropyl]-1H-indole |
|---|---|
| PubChem CID | 155524574 |
| Molecular Formula | C19H11Br2F5N2 |
| Molecular Weight | 522.11 g/mol |
| Exact Mass | 519.92 |
| IUPAC Name | 5-bromo-3-[1-(5-bromo-1H-indol-3-yl)-2,2,3,3,3-pentafluoropropyl]-1H-indole |
| SMILES | FC(F)(F)C(F)(F)C(c1c[nH]c2ccc(Br)cc12)c1c[nH]c2ccc(Br)cc12 |
| InChI | InChI=1S/C19H11Br2F5N2/c20-9-1-3-15-11(5-9)13(7-27-15)17(18(22,23)19(24,25)26)14-8-28-16-4-2-10(21)6-12(14)16/h1-8,17,27-28H |
| InChIKey | QEZRYQKCVRQHNQ-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.11 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|