C29H37NO3 — CID 155524671
methyl (2R)-2-[[(1R,4aS,10aR)-1-methyl-7-propan-2-yl-3,4,4a,9,10,10a-hexahydro-2H-phenanthrene-1-carbonyl]amino]-3-phenylpropanoate (PubChem CID 155524671) has the molecular formula C29H37NO3 and a molecular weight of 447.62 g/mol. Its IUPAC name is methyl (2R)-2-[[(1R,4aS,10aR)-1-methyl-7-propan-2-yl-3,4,4a,9,10,10a-hexahydro-2H-phenanthrene-1-carbonyl]amino]-3-phenylpropanoate.
| Compound Name | methyl (2R)-2-[[(1R,4aS,10aR)-1-methyl-7-propan-2-yl-3,4,4a,9,10,10a-hexahydro-2H-phenanthrene-1-carbonyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 155524671 |
| Molecular Formula | C29H37NO3 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.28 |
| IUPAC Name | methyl (2R)-2-[[(1R,4aS,10aR)-1-methyl-7-propan-2-yl-3,4,4a,9,10,10a-hexahydro-2H-phenanthrene-1-carbonyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@@H](Cc1ccccc1)NC(=O)[C@]1(C)CCC[C@@H]2c3ccc(C(C)C)cc3CC[C@H]21 |
| InChI | InChI=1S/C29H37NO3/c1-19(2)21-12-14-23-22(18-21)13-15-25-24(23)11-8-16-29(25,3)28(32)30-26(27(31)33-4)17-20-9-6-5-7-10-20/h5-7,9-10,12,14,18-19,24-26H,8,11,13,15-17H2,1-4H3,(H,30,32)/t24-,25-,26-,29-/m1/s1 |
| InChIKey | MKAHDTMUJWKIBO-GSTLAZBSSA-N |
| XLogP | 5.55 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |