C15H24O4 — CID 155524731
(E,5S,6R)-5,6-dihydroxy-2-methyl-6-[(1R)-4-methylcyclohex-3-en-1-yl]hept-2-enoic acid (PubChem CID 155524731) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (E,5S,6R)-5,6-dihydroxy-2-methyl-6-[(1R)-4-methylcyclohex-3-en-1-yl]hept-2-enoic acid.
| Compound Name | (E,5S,6R)-5,6-dihydroxy-2-methyl-6-[(1R)-4-methylcyclohex-3-en-1-yl]hept-2-enoic acid |
|---|---|
| PubChem CID | 155524731 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (E,5S,6R)-5,6-dihydroxy-2-methyl-6-[(1R)-4-methylcyclohex-3-en-1-yl]hept-2-enoic acid |
| SMILES | CC1=CC[C@H]([C@@](C)(O)[C@@H](O)C/C=C(\C)C(=O)O)CC1 |
| InChI | InChI=1S/C15H24O4/c1-10-4-7-12(8-5-10)15(3,19)13(16)9-6-11(2)14(17)18/h4,6,12-13,16,19H,5,7-9H2,1-3H3,(H,17,18)/b11-6+/t12-,13-,15+/m0/s1 |
| InChIKey | DHIQDGIZFCYWLZ-KBOBTTKFSA-N |
| XLogP | 2.27 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|