C29H34N4O2 — CID 155524775
N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-5-(1,2,3,4-tetrahydroacridin-9-ylamino)pentanamide (PubChem CID 155524775) has the molecular formula C29H34N4O2 and a molecular weight of 470.62 g/mol. Its IUPAC name is N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-5-(1,2,3,4-tetrahydroacridin-9-ylamino)pentanamide.
| Compound Name | N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-5-(1,2,3,4-tetrahydroacridin-9-ylamino)pentanamide |
|---|---|
| PubChem CID | 155524775 |
| Molecular Formula | C29H34N4O2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-5-(1,2,3,4-tetrahydroacridin-9-ylamino)pentanamide |
| SMILES | COc1ccc2[nH]cc(CCNC(=O)CCCCNc3c4c(nc5ccccc35)CCCC4)c2c1 |
| InChI | InChI=1S/C29H34N4O2/c1-35-21-13-14-25-24(18-21)20(19-32-25)15-17-30-28(34)12-6-7-16-31-29-22-8-2-4-10-26(22)33-27-11-5-3-9-23(27)29/h2,4,8,10,13-14,18-19,32H,3,5-7,9,11-12,15-17H2,1H3,(H,30,34)(H,31,33) |
| InChIKey | PHBSCELOIYHQSP-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|