About CID 155524810
CID 155524810 (PubChem CID 155524810) has the molecular formula C27H30N7O6
and a molecular weight of 548.58 g/mol.
Molecular Properties
| Compound Name | CID 155524810 |
| PubChem CID | 155524810 |
| Molecular Formula | C27H30N7O6 |
| Molecular Weight | 548.58 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(NC(=O)c2ccc(Nc3nc(Nc4ccc(C(=O)O)cc4)ncc3[N+](=O)[O-])cc2)CC(C)(C)N1[O] |
| InChI | InChI=1S/C27H30N7O6/c1-26(2)13-20(14-27(3,4)34(26)40)30-23(35)16-5-9-18(10-6-16)29-22-21(33(38)39)15-28-25(32-22)31-19-11-7-17(8-12-19)24(36)37/h5-12,15,20H,13-14H2,1-4H3,(H,30,35)(H,36,37)(H2,28,29,31,32) |
| InChIKey | AJORBWYMXISBMT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 182.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 548.58 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 155524810 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155524810?
The IUPAC name of CID 155524810 (CID 155524810) is not available.
What is the SMILES notation for CID 155524810?
The canonical SMILES for CID 155524810 is CC1(C)CC(NC(=O)c2ccc(Nc3nc(Nc4ccc(C(=O)O)cc4)ncc3[N+](=O)[O-])cc2)CC(C)(C)N1[O].
What is the InChIKey of CID 155524810?
The InChIKey is AJORBWYMXISBMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H30N7O6/c1-26(2)13-20(14-27(3,4)34(26)40)30-23(35)16-5-9-18(10-6-16)29-22-21(33(38)39)15-28-25(32-22)31-19-11-7-17(8-12-19)24(36)37/h5-12,15,20H,13-14H2,1-4H3,(H,30,35)(H,36,37)(H2,28,29,31,32).
What are the key properties of CID 155524810?
CID 155524810 has a molecular weight of 548.58 g/mol, XLogP of 4.67, 8 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155524810 is sourced from PubChem (CID 155524810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).