C17H13ClN4S — CID 155525123
2-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-[1,3]thiazolo[4,5-b]pyridine (PubChem CID 155525123) has the molecular formula C17H13ClN4S and a molecular weight of 340.84 g/mol. Its IUPAC name is 2-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-[1,3]thiazolo[4,5-b]pyridine.
| Compound Name | 2-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-[1,3]thiazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 155525123 |
| Molecular Formula | C17H13ClN4S |
| Molecular Weight | 340.84 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 2-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-[1,3]thiazolo[4,5-b]pyridine |
| SMILES | Clc1ccc2[nH]c3c(c2c1)CCN(c1nc2ncccc2s1)C3 |
| InChI | InChI=1S/C17H13ClN4S/c18-10-3-4-13-12(8-10)11-5-7-22(9-14(11)20-13)17-21-16-15(23-17)2-1-6-19-16/h1-4,6,8,20H,5,7,9H2 |
| InChIKey | GVMKKZMBUWLVPP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.84 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|