C13H12ClF3N4OS2 — CID 155525163
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)urea (PubChem CID 155525163) has the molecular formula C13H12ClF3N4OS2 and a molecular weight of 396.85 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 155525163 |
| Molecular Formula | C13H12ClF3N4OS2 |
| Molecular Weight | 396.85 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)urea |
| SMILES | CCCSc1nnc(NC(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C13H12ClF3N4OS2/c1-2-5-23-12-21-20-11(24-12)19-10(22)18-7-3-4-9(14)8(6-7)13(15,16)17/h3-4,6H,2,5H2,1H3,(H2,18,19,20,22) |
| InChIKey | OLIPKGPHFXVUFA-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.85 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|