C40H49N5O4 — CID 155525250
2-[(4-ethoxyphenyl)methyl]-N,N-diethyl-1-[2-[2-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethoxy]ethoxy]ethyl]benzimidazole-5-carboxamide (PubChem CID 155525250) has the molecular formula C40H49N5O4 and a molecular weight of 663.86 g/mol. Its IUPAC name is 2-[(4-ethoxyphenyl)methyl]-N,N-diethyl-1-[2-[2-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethoxy]ethoxy]ethyl]benzimidazole-5-carboxamide.
| Compound Name | 2-[(4-ethoxyphenyl)methyl]-N,N-diethyl-1-[2-[2-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethoxy]ethoxy]ethyl]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 155525250 |
| Molecular Formula | C40H49N5O4 |
| Molecular Weight | 663.86 g/mol |
| Exact Mass | 663.38 |
| IUPAC Name | 2-[(4-ethoxyphenyl)methyl]-N,N-diethyl-1-[2-[2-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethoxy]ethoxy]ethyl]benzimidazole-5-carboxamide |
| SMILES | CCOc1ccc(Cc2nc3cc(C(=O)N(CC)CC)ccc3n2CCOCCOCCNc2c3c(nc4ccccc24)CCCC3)cc1 |
| InChI | InChI=1S/C40H49N5O4/c1-4-44(5-2)40(46)30-17-20-37-36(28-30)43-38(27-29-15-18-31(19-16-29)49-6-3)45(37)22-24-48-26-25-47-23-21-41-39-32-11-7-9-13-34(32)42-35-14-10-8-12-33(35)39/h7,9,11,13,15-20,28H,4-6,8,10,12,14,21-27H2,1-3H3,(H,41,42) |
| InChIKey | QWAXIXJFJWHJOJ-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.86 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|