C21H33N3OS2 — CID 155525259
[(1R,2R,4S,9S,17S)-6-oxo-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-4-yl] piperidine-1-carbodithioate (PubChem CID 155525259) has the molecular formula C21H33N3OS2 and a molecular weight of 407.65 g/mol. Its IUPAC name is [(1R,2R,4S,9S,17S)-6-oxo-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-4-yl] piperidine-1-carbodithioate.
| Compound Name | [(1R,2R,4S,9S,17S)-6-oxo-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-4-yl] piperidine-1-carbodithioate |
|---|---|
| PubChem CID | 155525259 |
| Molecular Formula | C21H33N3OS2 |
| Molecular Weight | 407.65 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | [(1R,2R,4S,9S,17S)-6-oxo-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-4-yl] piperidine-1-carbodithioate |
| SMILES | O=C1C[C@@H](SC(=S)N2CCCCC2)C[C@@H]2[C@H]3CCCN4CCC[C@@H](CN12)[C@@H]34 |
| InChI | InChI=1S/C21H33N3OS2/c25-19-13-16(27-21(26)23-8-2-1-3-9-23)12-18-17-7-5-11-22-10-4-6-15(20(17)22)14-24(18)19/h15-18,20H,1-14H2/t15-,16-,17+,18+,20-/m0/s1 |
| InChIKey | AHWQKLXQPAXRTP-IPLXSBJHSA-N |
| XLogP | 3.35 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.65 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|